What is the molecular formula of 2-Iodobenzoic acid?
The molecular formula of 2-Iodobenzoic acid is C7H5IO2.
What is the molecular weight of 2-Iodobenzoic acid?
The molecular weight of 2-Iodobenzoic acid is 248.02 g/mol.
What is the IUPAC name of 2-Iodobenzoic acid?
The IUPAC name of 2-Iodobenzoic acid is 2-iodobenzoic acid.
What is the InChI of 2-Iodobenzoic acid?
The InChI of 2-Iodobenzoic acid is InChI=1S/C7H5IO2/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,(H,9,10).
What is the InChIKey of 2-Iodobenzoic acid?
The InChIKey of 2-Iodobenzoic acid is CJNZAXGUTKBIHP-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Iodobenzoic acid?
The canonical SMILES of 2-Iodobenzoic acid is C1=CC=C(C(=C1)C(=O)O)I.
What is the CAS number of 2-Iodobenzoic acid?
The CAS number of 2-Iodobenzoic acid is 88-67-5.
What is the ChEMBL ID of 2-Iodobenzoic acid?
The ChEMBL ID of 2-Iodobenzoic acid is CHEMBL112424.
What is the molecular weight of 2-Iodobenzoic acid in g/mol?
The molecular weight of 2-Iodobenzoic acid is 248.02 g/mol.
What is the hydrogen bond donor count of 2-Iodobenzoic acid?
The hydrogen bond donor count of 2-Iodobenzoic acid is 1.