What is the molecular formula of (R)-(+)-Chlocyphos?
The molecular formula of (R)-(+)-Chlocyphos is C11H14ClO4P.
What is the molecular weight of (R)-(+)-Chlocyphos?
The molecular weight of (R)-(+)-Chlocyphos is 276.65 g/mol.
What is the IUPAC name of (R)-(+)-Chlocyphos?
The IUPAC name of (R)-(+)-Chlocyphos is (4R)-4-(2-chlorophenyl)-2-hydroxy-5,5-dimethyl-1,3,2λ 5 -dioxaphosphinane 2-oxide.
What is the InChI of (R)-(+)-Chlocyphos?
The InChI of (R)-(+)-Chlocyphos is InChI=1S/C11H14ClO4P/c1-11(2)7-15-17(13,14)16-10(11)8-5-3-4-6-9(8)12/h3-6,10H,7H2,1-2H3,(H,13,14)/t10-/m0/s1.
What is the InChIKey of (R)-(+)-Chlocyphos?
The InChIKey of (R)-(+)-Chlocyphos is ZPSPULCZMWMHCY-JTQLQIEISA-N.
What is the canonical SMILES of (R)-(+)-Chlocyphos?
The canonical SMILES of (R)-(+)-Chlocyphos is CC1(COP(=O)(OC1C2=CC=CC=C2Cl)O)C.
What is the isomeric SMILES of (R)-(+)-Chlocyphos?
The isomeric SMILES of (R)-(+)-Chlocyphos is CC1(COP(=O)(O[C@H]1C2=CC=CC=C2Cl)O)C.
What is the CAS number of (R)-(+)-Chlocyphos?
The CAS number of (R)-(+)-Chlocyphos is 98674-87-4.
What is the European Community (EC) number of (R)-(+)-Chlocyphos?
The European Community (EC) number of (R)-(+)-Chlocyphos is 623-402-3.
What is the XLogP3-AA value of (R)-(+)-Chlocyphos?
The XLogP3-AA value of (R)-(+)-Chlocyphos is 2.1.