What is the PubChem CID of 5,6-Diamino-2,2-difluorobenzodioxole dihydrochloride?
PubChem CID 67230531.
What is the molecular formula of 5,6-Diamino-2,2-difluorobenzodioxole dihydrochloride?
The molecular formula is C7H8Cl2F2N2O2.
What are the synonyms of 5,6-Diamino-2,2-difluorobenzodioxole dihydrochloride?
The synonyms are 97966-69-3, 2,2-difluoro-1,3-benzodioxole-5,6-diamine;dihydrochloride, 5,6-Diamino-2,2-difluorobenzodioxole, Dihydrochloride, 2,2-Difluoro-2H-1,3-benzodioxole-5,6-diamine dihydrochloride, SCHEMBL1966185, and more.
What is the molecular weight of 5,6-Diamino-2,2-difluorobenzodioxole dihydrochloride?
The molecular weight is 261.05 g/mol.
What is the IUPAC name of 5,6-Diamino-2,2-difluorobenzodioxole dihydrochloride?
The IUPAC name is 2,2-difluoro-1,3-benzodioxole-5,6-diamine;dihydrochloride.
What is the InChI of 5,6-Diamino-2,2-difluorobenzodioxole dihydrochloride?
The InChI is InChI=1S/C7H6F2N2O2.2ClH/c8-7(9)12-5-1-3(10)4(11)2-6(5)13-7;;/h1-2H,10-11H2;2*1H.
What is the InChIKey of 5,6-Diamino-2,2-difluorobenzodioxole dihydrochloride?
The InChIKey is SKOXLEGHXUPGTK-UHFFFAOYSA-N.
What is the canonical SMILES of 5,6-Diamino-2,2-difluorobenzodioxole dihydrochloride?
The canonical SMILES is C1=C(C(=CC2=C1OC(O2)(F)F)N)N.Cl.Cl.
How many hydrogen bond donor counts does 5,6-Diamino-2,2-difluorobenzodioxole dihydrochloride have?
It has 4 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 5,6-Diamino-2,2-difluorobenzodioxole dihydrochloride have?
It has 6 hydrogen bond acceptor counts.
※ Please kindly note that our products are for research use only.