What is the molecular formula of Lorglumide?
The molecular formula of Lorglumide is C22H32Cl2N2O4.
What is the molecular weight of Lorglumide?
The molecular weight of Lorglumide is 459.4 g/mol.
What is the IUPAC name of Lorglumide?
The IUPAC name of Lorglumide is 4-[(3,4-dichlorobenzoyl)amino]-5-(dipentylamino)-5-oxopentanoic acid.
What is the InChIKey of Lorglumide?
The InChIKey of Lorglumide is IEKOTSCYBBDIJC-UHFFFAOYSA-N.
What is the Canonical SMILES representation of Lorglumide?
The Canonical SMILES representation of Lorglumide is CCCCCN(CCCCC)C(=O)C(CCC(=O)O)NC(=O)C1=CC(=C(C=C1)Cl)Cl.
What is the CAS number of Lorglumide?
The CAS number of Lorglumide is 97964-56-2.
How many hydrogen bond donor count does Lorglumide have?
Lorglumide has 2 hydrogen bond donor count.
How many hydrogen bond acceptor count does Lorglumide have?
Lorglumide has 4 hydrogen bond acceptor count.
How many rotatable bond count does Lorglumide have?
Lorglumide has 14 rotatable bond count.
What is the topological polar surface area of Lorglumide?
The topological polar surface area of Lorglumide is 86.7 Å2.