What is the molecular formula of nebracetam?
The molecular formula of nebracetam is C12H16N2O.
What is the molecular weight of nebracetam?
The molecular weight of nebracetam is 204.27 g/mol.
What is the IUPAC name of nebracetam?
The IUPAC name of nebracetam is 4-(aminomethyl)-1-benzylpyrrolidin-2-one.
What is the InChI of nebracetam?
The InChI of nebracetam is InChI=1S/C12H16N2O/c13-7-11-6-12(15)14(9-11)8-10-4-2-1-3-5-10/h1-5,11H,6-9,13H2.
What is the InChIKey of nebracetam?
The InChIKey of nebracetam is LCAFGJGYCUMTGS-UHFFFAOYSA-N.
What is the canonical SMILES of nebracetam?
The canonical SMILES of nebracetam is C1C(CN(C1=O)CC2=CC=CC=C2)CN.
What is the CAS number of nebracetam?
The CAS number of nebracetam is 97205-34-0.
What is the UNII of nebracetam?
The UNII of nebracetam is T30038QI8N.
What is the ChEMBL ID of nebracetam?
The ChEMBL ID of nebracetam is CHEMBL2104682.
Is nebracetam a canonicalized compound?
Yes, nebracetam is a canonicalized compound.