What is the molecular formula of 4-Decoxybutan-2-ol?
The molecular formula of 4-Decoxybutan-2-ol is C14H30O2.
What is the molecular weight of 4-Decoxybutan-2-ol?
The molecular weight of 4-Decoxybutan-2-ol is 230.39 g/mol.
When was 4-Decoxybutan-2-ol created in PubChem?
4-Decoxybutan-2-ol was created in PubChem on August 8, 2005.
When was 4-Decoxybutan-2-ol last modified in PubChem?
4-Decoxybutan-2-ol was last modified in PubChem on December 30, 2023.
What is the IUPAC name of 4-Decoxybutan-2-ol?
The IUPAC name of 4-Decoxybutan-2-ol is 4-decoxybutan-2-ol.
What is the InChI of 4-Decoxybutan-2-ol?
The InChI of 4-Decoxybutan-2-ol is InChI=1S/C14H30O2/c1-3-4-5-6-7-8-9-10-12-16-13-11-14(2)15/h14-15H,3-13H2,1-2H3.
What is the InChIKey of 4-Decoxybutan-2-ol?
The InChIKey of 4-Decoxybutan-2-ol is UCMHUESBHQTSMQ-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Decoxybutan-2-ol?
The canonical SMILES of 4-Decoxybutan-2-ol is CCCCCCCCCCOCCC(C)O.
What is the CAS number of 4-Decoxybutan-2-ol?
The CAS number of 4-Decoxybutan-2-ol is 97209-96-6.
What is the XLogP3-AA value of 4-Decoxybutan-2-ol?
The XLogP3-AA value of 4-Decoxybutan-2-ol is 4.7.