What is the PubChem CID of 5-Acetylthiophene-2-boronic acid pinacol ester?
The PubChem CID of 5-Acetylthiophene-2-boronic acid pinacol ester is 53398602.
What is the molecular formula of 5-Acetylthiophene-2-boronic acid pinacol ester?
The molecular formula of 5-Acetylthiophene-2-boronic acid pinacol ester is C12H17BO3S.
What are the synonyms of 5-Acetylthiophene-2-boronic acid pinacol ester?
The synonyms of 5-Acetylthiophene-2-boronic acid pinacol ester are 942070-32-8, 1-(5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)THIOPHEN-2-YL)ETHANONE, and 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]ethanone.
What is the molecular weight of 5-Acetylthiophene-2-boronic acid pinacol ester?
The molecular weight of 5-Acetylthiophene-2-boronic acid pinacol ester is 252.14 g/mol.
What is the IUPAC name of 5-Acetylthiophene-2-boronic acid pinacol ester?
The IUPAC name of 5-Acetylthiophene-2-boronic acid pinacol ester is 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]ethanone.
What is the InChI of 5-Acetylthiophene-2-boronic acid pinacol ester?
The InChI of 5-Acetylthiophene-2-boronic acid pinacol ester is InChI=1S/C12H17BO3S/c1-8(14)9-6-7-10(17-9)13-15-11(2,3)12(4,5)16-13/h6-7H,1-5H3.
What is the InChIKey of 5-Acetylthiophene-2-boronic acid pinacol ester?
The InChIKey of 5-Acetylthiophene-2-boronic acid pinacol ester is NQCVKFAFBSIAPA-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Acetylthiophene-2-boronic acid pinacol ester?
The canonical SMILES of 5-Acetylthiophene-2-boronic acid pinacol ester is B1(OC(C(O1)(C)C)(C)C)C2=CC=C(S2)C(=O)C.
What is the CAS number of 5-Acetylthiophene-2-boronic acid pinacol ester?
The CAS number of 5-Acetylthiophene-2-boronic acid pinacol ester is 942070-32-8.
Is 5-Acetylthiophene-2-boronic acid pinacol ester canonicalized?
Yes, 5-Acetylthiophene-2-boronic acid pinacol ester is canonicalized.
※ Please kindly note that our products are for research use only.
Download
