What is the molecular formula of 4-Iodo-5-pyrimidinamine?
The molecular formula of 4-Iodo-5-pyrimidinamine is C4H4IN3.
What is the molecular weight of 4-Iodo-5-pyrimidinamine?
The molecular weight of 4-Iodo-5-pyrimidinamine is 221.00 g/mol.
When was 4-Iodo-5-pyrimidinamine created?
4-Iodo-5-pyrimidinamine was created on May 31, 2013.
When was 4-Iodo-5-pyrimidinamine last modified?
4-Iodo-5-pyrimidinamine was last modified on December 30, 2023.
What is the IUPAC name of 4-Iodo-5-pyrimidinamine?
The IUPAC name of 4-Iodo-5-pyrimidinamine is 4-iodopyrimidin-5-amine.
What is the InChI of 4-Iodo-5-pyrimidinamine?
The InChI of 4-Iodo-5-pyrimidinamine is InChI=1S/C4H4IN3/c5-4-3(6)1-7-2-8-4/h1-2H,6H2.
What is the InChIKey of 4-Iodo-5-pyrimidinamine?
The InChIKey of 4-Iodo-5-pyrimidinamine is XIUJCJNURUXNKT-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Iodo-5-pyrimidinamine?
The canonical SMILES of 4-Iodo-5-pyrimidinamine is C1=C(C(=NC=N1)I)N.
What is the CAS number of 4-Iodo-5-pyrimidinamine?
The CAS number of 4-Iodo-5-pyrimidinamine is 942067-98-3.
What is the molecular weight of 4-Iodo-5-pyrimidinamine according to PubChem?
The molecular weight of 4-Iodo-5-pyrimidinamine is 221.00 g/mol according to PubChem.