What is the molecular formula of N-D-Gluconoyl-L-cysteine?
The molecular formula of N-D-Gluconoyl-L-cysteine is C9H17NO8S.
What are the synonyms for N-D-Gluconoyl-L-cysteine?
The synonyms for N-D-Gluconoyl-L-cysteine are 94071-03-1, EINECS 301-803-1, and DTXSID00240368.
What is the molecular weight of N-D-Gluconoyl-L-cysteine?
The molecular weight of N-D-Gluconoyl-L-cysteine is 299.30 g/mol.
What is the IUPAC name of N-D-Gluconoyl-L-cysteine?
The IUPAC name of N-D-Gluconoyl-L-cysteine is (2R)-2-[[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]-3-sulfanylpropanoic acid.
What is the InChI of N-D-Gluconoyl-L-cysteine?
The InChI of N-D-Gluconoyl-L-cysteine is InChI=1S/C9H17NO8S/c11-1-4(12)5(13)6(14)7(15)8(16)10-3(2-19)9(17)18/h3-7,11-15,19H,1-2H2,(H,10,16)(H,17,18)/t3-,4+,5+,6-,7+/m0/s1.
What is the InChIKey of N-D-Gluconoyl-L-cysteine?
The InChIKey of N-D-Gluconoyl-L-cysteine is CRUSWOCJZFSQPD-CXNFULCWSA-N.
What is the canonical SMILES of N-D-Gluconoyl-L-cysteine?
The canonical SMILES of N-D-Gluconoyl-L-cysteine is C(C(C(C(C(C(=O)NC(CS)C(=O)O)O)O)O)O)O.
What is the isomeric SMILES of N-D-Gluconoyl-L-cysteine?
The isomeric SMILES of N-D-Gluconoyl-L-cysteine is C([C@H]([C@H]([C@@H]([C@H](C(=O)N[C@@H](CS)C(=O)O)O)O)O)O)O.
What is the CAS number of N-D-Gluconoyl-L-cysteine?
The CAS number of N-D-Gluconoyl-L-cysteine is 94071-03-1.