What is the PubChem CID for N-D-Gluconoyl-L-valine?
The PubChem CID is 7909380.
What is the molecular formula of N-D-Gluconoyl-L-valine?
The molecular formula is C11H21NO8.
What are the synonyms for N-D-Gluconoyl-L-valine?
The synonyms are N-D-Gluconoyl-L-valine, EINECS 301-806-8, 94071-06-4, and DTXSID30240371.
What is the molecular weight of N-D-Gluconoyl-L-valine?
The molecular weight is 295.29 g/mol.
What is the IUPAC name of N-D-Gluconoyl-L-valine?
The IUPAC name is (2S)-3-methyl-2-[[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]butanoic acid.
What is the InChI of N-D-Gluconoyl-L-valine?
The InChI is InChI=1S/C11H21NO8/c1-4(2)6(11(19)20)12-10(18)9(17)8(16)7(15)5(14)3-13/h4-9,13-17H,3H2,1-2H3,(H,12,18)(H,19,20)/t5-,6+,7-,8+,9-/m1/s1.
What is the InChIKey of N-D-Gluconoyl-L-valine?
The InChIKey is ARPJJMSZXXSGRQ-QKCLAQEOSA-N.
What is the canonical SMILES of N-D-Gluconoyl-L-valine?
The canonical SMILES is CC(C)C(C(=O)O)NC(=O)C(C(C(C(CO)O)O)O)O.
What is the isomeric SMILES of N-D-Gluconoyl-L-valine?
The isomeric SMILES is CC(C)[C@@H](C(=O)O)NC(=O)[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O.
What is the CAS number of N-D-Gluconoyl-L-valine?
The CAS number is 94071-06-4.
Download
![n2-D-Gluconoyl-n5-[(d-gluconoylamino)iminomethyl]-L-ornithine](https://resource.alfa-chemistry.com/structure/94071-05-3.gif)
