What is the molecular formula of Xylenedisulfonic acid?
The molecular formula of Xylenedisulfonic acid is C8H10O6S2.
What are the synonyms of Xylenedisulfonic acid?
The synonyms of Xylenedisulfonic acid are Xylenedisulphonic acid, EINECS 299-823-8, and 93904-89-3.
When was Xylenedisulfonic acid first created?
Xylenedisulfonic acid was first created on December 5, 2007.
What is the InChIKey of Xylenedisulfonic acid?
The InChIKey of Xylenedisulfonic acid is NNXMZFSCTRDIBY-UHFFFAOYSA-N.
What is the Canonical SMILES representation of Xylenedisulfonic acid?
The Canonical SMILES representation of Xylenedisulfonic acid is CC1=CC=C(C=C1)C(S(=O)(=O)O)S(=O)(=O)O.
What is the molecular weight of Xylenedisulfonic acid?
The molecular weight of Xylenedisulfonic acid is 266.3 g/mol.
How many Hydrogen Bond Donor Count does Xylenedisulfonic acid have?
Xylenedisulfonic acid has 2 Hydrogen Bond Donor Count.
What is the Heavy Atom Count of Xylenedisulfonic acid?
The Heavy Atom Count of Xylenedisulfonic acid is 16.
Is Xylenedisulfonic acid a canonicalized compound?
Yes, Xylenedisulfonic acid is a canonicalized compound.
What is the exact mass and monoisotopic mass of Xylenedisulfonic acid?
The exact mass and monoisotopic mass of Xylenedisulfonic acid are both 265.99188038 g/mol.