What is the molecular formula of (Hexyloxy)methylpyrazine?
The molecular formula of (Hexyloxy)methylpyrazine is C11H18N2O.
What is the molecular weight of (Hexyloxy)methylpyrazine?
The molecular weight of (Hexyloxy)methylpyrazine is 194.27 g/mol.
What is the IUPAC name of (Hexyloxy)methylpyrazine?
The IUPAC name of (Hexyloxy)methylpyrazine is 2-hexoxy-3-methylpyrazine.
What is the InChI of (Hexyloxy)methylpyrazine?
The InChI of (Hexyloxy)methylpyrazine is InChI=1S/C11H18N2O/c1-3-4-5-6-9-14-11-10(2)12-7-8-13-11/h7-8H,3-6,9H2,1-2H3.
What is the InChIKey of (Hexyloxy)methylpyrazine?
The InChIKey of (Hexyloxy)methylpyrazine is IOTVUKNWZQTXFS-UHFFFAOYSA-N.
What is the canonical SMILES of (Hexyloxy)methylpyrazine?
The canonical SMILES of (Hexyloxy)methylpyrazine is CCCCCCOC1=NC=CN=C1C.
What is the CAS number of (Hexyloxy)methylpyrazine?
The CAS number of (Hexyloxy)methylpyrazine is 223719-33-3.
What is the XLogP3 value of (Hexyloxy)methylpyrazine?
The XLogP3 value of (Hexyloxy)methylpyrazine is 3.8.
How many hydrogen bond donor counts does (Hexyloxy)methylpyrazine have?
(Hexyloxy)methylpyrazine has 0 hydrogen bond donor counts.
How many rotatable bond counts does (Hexyloxy)methylpyrazine have?
(Hexyloxy)methylpyrazine has 6 rotatable bond counts.