What is the molecular formula of H-Ala-ala-ala-ala-oh?
The molecular formula of H-Ala-ala-ala-ala-oh is C12H22N4O5.
What is the molecular weight of H-Ala-ala-ala-ala-oh?
The molecular weight of H-Ala-ala-ala-ala-oh is 302.33 g/mol.
What is the IUPAC name of H-Ala-ala-ala-ala-oh?
The IUPAC name of H-Ala-ala-ala-ala-oh is (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]propanoyl]amino]propanoic acid.
What is the InChI of H-Ala-ala-ala-ala-oh?
The InChI of H-Ala-ala-ala-ala-oh is InChI=1S/C12H22N4O5/c1-5(13)9(17)14-6(2)10(18)15-7(3)11(19)16-8(4)12(20)21/h5-8H,13H2,1-4H3,(H,14,17)(H,15,18)(H,16,19)(H,20,21)/t5-,6-,7-,8-/m0/s1.
What is the InChIKey of H-Ala-ala-ala-ala-oh?
The InChIKey of H-Ala-ala-ala-ala-oh is ZHRZLXZJVUFLNY-XAMCCFCMSA-N.
What is the canonical SMILES of H-Ala-ala-ala-ala-oh?
The canonical SMILES of H-Ala-ala-ala-ala-oh is CC(C(=O)NC(C)C(=O)NC(C)C(=O)NC(C)C(=O)O)N.
What is the CAS number of H-Ala-ala-ala-ala-oh?
The CAS number of H-Ala-ala-ala-ala-oh is 926-79-4.
What is the European Community (EC) number of H-Ala-ala-ala-ala-oh?
The European Community (EC) number of H-Ala-ala-ala-ala-oh is 213-145-1.
What is the ChEMBL ID of H-Ala-ala-ala-ala-oh?
The ChEMBL ID of H-Ala-ala-ala-ala-oh is CHEMBL2074927.