What is the molecular formula of H-D-Ala-D-ala-D-ala-D-ala-oh?
The molecular formula of H-D-Ala-D-ala-D-ala-D-ala-oh is C12H22N4O5.
What is the molecular weight of H-D-Ala-D-ala-D-ala-D-ala-oh?
The molecular weight of H-D-Ala-D-ala-D-ala-D-ala-oh is 302.33 g/mol.
When was H-D-Ala-D-ala-D-ala-D-ala-oh created?
H-D-Ala-D-ala-D-ala-D-ala-oh was created on July 29, 2006.
What is the IUPAC name of H-D-Ala-D-ala-D-ala-D-ala-oh?
The IUPAC name of H-D-Ala-D-ala-D-ala-D-ala-oh is (2R)-2-[[(2R)-2-[[(2R)-2-[[(2R)-2-aminopropanoyl]amino]propanoyl]amino]propanoyl]amino]propanoic acid.
What is the InChI of H-D-Ala-D-ala-D-ala-D-ala-oh?
The InChI of H-D-Ala-D-ala-D-ala-D-ala-oh is InChI=1S/C12H22N4O5/c1-5(13)9(17)14-6(2)10(18)15-7(3)11(19)16-8(4)12(20)21/h5-8H,13H2,1-4H3,(H,14,17)(H,15,18)(H,16,19)(H,20,21)/t5-,6-,7-,8-/m1/s1.
What is the InChIKey of H-D-Ala-D-ala-D-ala-D-ala-oh?
The InChIKey of H-D-Ala-D-ala-D-ala-D-ala-oh is ZHRZLXZJVUFLNY-WCTZXXKLSA-N.
What is the Canonical SMILES of H-D-Ala-D-ala-D-ala-D-ala-oh?
The Canonical SMILES of H-D-Ala-D-ala-D-ala-D-ala-oh is CC(C(=O)NC(C)C(=O)NC(C)C(=O)NC(C)C(=O)O)N.
How many hydrogen bond donor counts does H-D-Ala-D-ala-D-ala-D-ala-oh have?
H-D-Ala-D-ala-D-ala-D-ala-oh has 5 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does H-D-Ala-D-ala-D-ala-D-ala-oh have?
H-D-Ala-D-ala-D-ala-D-ala-oh has 6 hydrogen bond acceptor counts.
※ Please kindly note that our products are for research use only.