What is the PubChem CID for this compound?
PubChem CID 879536.
What is the molecular formula of the compound?
The molecular formula is C17H14ClNO.
What is the molecular weight of the compound?
The molecular weight is 283.7 g/mol.
When was the compound created in PubChem?
The compound was created on July 9, 2005.
What is the IUPAC name of the compound?
The IUPAC name is 1-[(2-chlorophenyl)methyl]-2-methylindole-3-carbaldehyde.
What is the InChI of the compound?
The InChI is InChI=1S/C17H14ClNO/c1-12-15(11-20)14-7-3-5-9-17(14)19(12)10-13-6-2-4-8-16(13)18/h2-9,11H,10H2,1H3.
What is the InChIKey of the compound?
The InChIKey is VKZUESSMSHLLQC-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES is CC1=C(C2=CC=CC=C2N1CC3=CC=CC=C3Cl)C=O.
What is the CAS number of the compound?
The CAS number is 92407-84-6.
Is the compound canonicalized?
Yes, the compound is canonicalized.