What is the molecular formula of Asischem r41968?
The molecular formula of Asischem r41968 is C17H14ClNO.
What is the molecular weight of Asischem r41968?
The molecular weight of Asischem r41968 is 283.7 g/mol.
What is the IUPAC name of Asischem r41968?
The IUPAC name of Asischem r41968 is 1-[(4-chlorophenyl)methyl]-2-methylindole-3-carbaldehyde.
What is the InChI of Asischem r41968?
The InChI of Asischem r41968 is InChI=1S/C17H14ClNO/c1-12-16(11-20)15-4-2-3-5-17(15)19(12)10-13-6-8-14(18)9-7-13/h2-9,11H,10H2,1H3.
What is the InChIKey of Asischem r41968?
The InChIKey of Asischem r41968 is GDKIFZJBJKSAOH-UHFFFAOYSA-N.
What is the canonical SMILES of Asischem r41968?
The canonical SMILES of Asischem r41968 is CC1=C(C2=CC=CC=C2N1CC3=CC=C(C=C3)Cl)C=O.
What is the XLogP3-AA value of Asischem r41968?
The XLogP3-AA value of Asischem r41968 is 4.1.
How many hydrogen bond donor counts does Asischem r41968 have?
Asischem r41968 has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Asischem r41968 have?
Asischem r41968 has 1 hydrogen bond acceptor count.
How many rotatable bond counts does Asischem r41968 have?
Asischem r41968 has 3 rotatable bond counts.