What is the molecular formula of Dizatrifone?
The molecular formula of Dizatrifone is C21H21N3O3.
What is the molecular weight of Dizatrifone?
The molecular weight of Dizatrifone is 363.4 g/mol.
What is the IUPAC name of Dizatrifone?
The IUPAC name of Dizatrifone is 2-(cyclopropylmethyl)-5,6-bis(4-methoxyphenyl)-1,2,4-triazin-3-one.
What is the InChI of Dizatrifone?
The InChI of Dizatrifone is InChI=1S/C21H21N3O3/c1-26-17-9-5-15(6-10-17)19-20(16-7-11-18(27-2)12-8-16)23-24(21(25)22-19)13-14-3-4-14/h5-12,14H,3-4,13H2,1-2H3.
What is the InChIKey of Dizatrifone?
The InChIKey of Dizatrifone is DMEHEIWCWDNUBJ-UHFFFAOYSA-N.
What is the canonical SMILES of Dizatrifone?
The canonical SMILES of Dizatrifone is COC1=CC=C(C=C1)C2=NC(=O)N(N=C2C3=CC=C(C=C3)OC)CC4CC4.
What is the CAS number of Dizatrifone?
The CAS number of Dizatrifone is 92257-40-4.
What is the UNII of Dizatrifone?
The UNII of Dizatrifone is 913423W85V.
What is the ChEMBL ID of Dizatrifone?
The ChEMBL ID of Dizatrifone is CHEMBL2104279.
What is the molecular weight of Dizatrifone according to PubChem?
The molecular weight of Dizatrifone according to PubChem is 363.4 g/mol.