What is the molecular formula of 2,2-dihydroxy-1-(4-phenoxyphenyl)ethanone?
The molecular formula is C14H12O4.
What are the synonyms for 2,2-dihydroxy-1-(4-phenoxyphenyl)ethanone?
The synonyms are 2,2-dihydroxy-1-(4-phenoxyphenyl)ethanone, CS-0156089, Oxo-(4-phenoxy-phenyl)-acetaldehyde hydrate, and ETHANONE,2,2-DIHYDROXY-1-(4-PHENOXYPHENYL)-.
What is the molecular weight of 2,2-dihydroxy-1-(4-phenoxyphenyl)ethanone?
The molecular weight is 244.24 g/mol.
What is the IUPAC name of 2,2-dihydroxy-1-(4-phenoxyphenyl)ethanone?
The IUPAC name is 2,2-dihydroxy-1-(4-phenoxyphenyl)ethanone.
What is the InChI of 2,2-dihydroxy-1-(4-phenoxyphenyl)ethanone?
The InChI is InChI=1S/C14H12O4/c15-13(14(16)17)10-6-8-12(9-7-10)18-11-4-2-1-3-5-11/h1-9,14,16-17H.
What is the InChIKey of 2,2-dihydroxy-1-(4-phenoxyphenyl)ethanone?
The InChIKey is YXORSXKQALCDKI-UHFFFAOYSA-N.
What is the canonical SMILES of 2,2-dihydroxy-1-(4-phenoxyphenyl)ethanone?
The canonical SMILES is C1=CC=C(C=C1)OC2=CC=C(C=C2)C(=O)C(O)O.
What is the XLogP3-AA value of 2,2-dihydroxy-1-(4-phenoxyphenyl)ethanone?
The XLogP3-AA value is 1.9.
What is the hydrogen bond donor count of 2,2-dihydroxy-1-(4-phenoxyphenyl)ethanone?
The hydrogen bond donor count is 2.
What is the hydrogen bond acceptor count of 2,2-dihydroxy-1-(4-phenoxyphenyl)ethanone?
The hydrogen bond acceptor count is 4.
※ Please kindly note that our products are for research use only.