What is the molecular formula for Chembrdg-bb 9000271?
The molecular formula for Chembrdg-bb 9000271 is C13H15NO2.
When was Chembrdg-bb 9000271 created and modified?
Chembrdg-bb 9000271 was created on May 30, 2009, and modified on December 30, 2023.
What is the IUPAC name of Chembrdg-bb 9000271?
The IUPAC name of Chembrdg-bb 9000271 is 1-[1-(2-methoxyethyl)indol-3-yl]ethanone.
What is the InChI of Chembrdg-bb 9000271?
The InChI of Chembrdg-bb 9000271 is InChI=1S/C13H15NO2/c1-10(15)12-9-14(7-8-16-2)13-6-4-3-5-11(12)13/h3-6,9H,7-8H2,1-2H3.
What is the InChIKey of Chembrdg-bb 9000271?
The InChIKey of Chembrdg-bb 9000271 is QYTHXNOXCIMWCU-UHFFFAOYSA-N.
What is the molecular weight of Chembrdg-bb 9000271?
The molecular weight of Chembrdg-bb 9000271 is 217.26 g/mol.
How many hydrogen bond donor counts does Chembrdg-bb 9000271 have?
Chembrdg-bb 9000271 has 0 hydrogen bond donor count.
What is the topological polar surface area of Chembrdg-bb 9000271?
The topological polar surface area of Chembrdg-bb 9000271 is 31.2 Ų.
Is Chembrdg-bb 9000271 a canonicalized compound?
Yes, Chembrdg-bb 9000271 is a canonicalized compound.
What is the exact mass of Chembrdg-bb 9000271?
The exact mass of Chembrdg-bb 9000271 is 217.110278721 g/mol.
Download
