What is the molecular formula of Chembrdg-bb 9038698?
The molecular formula of Chembrdg-bb 9038698 is C14H12N4O.
What are the synonyms for Chembrdg-bb 9038698?
The synonyms for Chembrdg-bb 9038698 are 915916-58-4, 4-methyl-2-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)aniline, and 4-Methyl-2-(5-(pyridin-4-yl)-1,3,4-oxadiazol-2-yl)aniline.
What is the molecular weight of Chembrdg-bb 9038698?
The molecular weight of Chembrdg-bb 9038698 is 252.27 g/mol.
When was Chembrdg-bb 9038698 created?
Chembrdg-bb 9038698 was created on April 29, 2006.
When was Chembrdg-bb 9038698 last modified?
Chembrdg-bb 9038698 was last modified on December 30, 2023.
What is the IUPAC name of Chembrdg-bb 9038698?
The IUPAC name of Chembrdg-bb 9038698 is 4-methyl-2-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)aniline.
What is the InChI of Chembrdg-bb 9038698?
The InChI of Chembrdg-bb 9038698 is InChI=1S/C14H12N4O/c1-9-2-3-12(15)11(8-9)14-18-17-13(19-14)10-4-6-16-7-5-10/h2-8H,15H2,1H3.
What is the InChIKey of Chembrdg-bb 9038698?
The InChIKey of Chembrdg-bb 9038698 is WJWIYDXADATTEL-UHFFFAOYSA-N.
What is the canonical SMILES of Chembrdg-bb 9038698?
The canonical SMILES of Chembrdg-bb 9038698 is CC1=CC(=C(C=C1)N)C2=NN=C(O2)C3=CC=NC=C3.
What is the CAS number of Chembrdg-bb 9038698?
The CAS number of Chembrdg-bb 9038698 is 915916-58-4.