What is the molecular formula of Solvent Violet 14?
The molecular formula of Solvent Violet 14 is C28H22N2O2.
What is the molecular weight of Solvent Violet 14?
The molecular weight of Solvent Violet 14 is 418.5 g/mol.
What is the IUPAC name of Solvent Violet 14?
The IUPAC name of Solvent Violet 14 is 1,5-bis(4-methylanilino)anthracene-9,10-dione.
What is the InChIKey of Solvent Violet 14?
The InChIKey of Solvent Violet 14 is ZKIVUFFTMWIBCO-UHFFFAOYSA-N.
What is the canonical SMILES representation of Solvent Violet 14?
The canonical SMILES representation of Solvent Violet 14 is CC1=CC=C(C=C1)NC2=CC=CC3=C2C(=O)C4=C(C3=O)C(=CC=C4)NC5=CC=C(C=C5)C.
What is the CAS number of Solvent Violet 14?
The CAS number of Solvent Violet 14 is 82-20-2.
What is the XLogP3-AA value of Solvent Violet 14?
The XLogP3-AA value of Solvent Violet 14 is 7.8.
How many hydrogen bond donor counts does Solvent Violet 14 have?
Solvent Violet 14 has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Solvent Violet 14 have?
Solvent Violet 14 has 4 hydrogen bond acceptor counts.
What is the topological polar surface area of Solvent Violet 14?
The topological polar surface area of Solvent Violet 14 is 58.2?2.