What is the molecular formula of Solvent Blue 6?
The molecular formula of Solvent Blue 6 is C29H33N3O.
What is the molecular weight of Solvent Blue 6?
The molecular weight of Solvent Blue 6 is 439.6 g/mol.
What is the IUPAC name of Solvent Blue 6?
The IUPAC name of Solvent Blue 6 is bis[4-(dimethylamino)phenyl]-[4-(ethylamino)naphthalen-1-yl]methanol.
What is the InChI of Solvent Blue 6?
The InChI of Solvent Blue 6 is InChI=1S/C29H33N3O/c1-6-30-28-20-19-27(25-9-7-8-10-26(25)28)29(33,21-11-15-23(16-12-21)31(2)3)22-13-17-24(18-14-22)32(4)5/h7-20,30,33H,6H2,1-5H3.
What is the InChIKey of Solvent Blue 6?
The InChIKey of Solvent Blue 6 is POGFPZCWAIFSIW-UHFFFAOYSA-N.
What is the canonical SMILES representation of Solvent Blue 6?
The canonical SMILES representation of Solvent Blue 6 is CCNC1=CC=C(C2=CC=CC=C21)C(C3=CC=C(C=C3)N(C)C)(C4=CC=C(C=C4)N(C)C)O.
What is the CAS number of Solvent Blue 6?
The CAS number of Solvent Blue 6 is 6786-84-1.
What is the XLogP3-AA value of Solvent Blue 6?
The XLogP3-AA value of Solvent Blue 6 is 6.1.
How many hydrogen bond donor counts does Solvent Blue 6 have?
Solvent Blue 6 has 2 hydrogen bond donor counts.
How many rotatable bond counts does Solvent Blue 6 have?
Solvent Blue 6 has 7 rotatable bond counts.