What is the molecular formula of Sodium 2,3,3-Trichloroprop-2-Ene-1-Sulfonate?
The molecular formula is C3H2Cl3NaO3S.
What is the molecular weight of Sodium 2,3,3-Trichloroprop-2-Ene-1-Sulfonate?
The molecular weight is 247.5 g/mol.
What are the synonyms of Sodium 2,3,3-Trichloroprop-2-Ene-1-Sulfonate?
The synonyms are 65600-61-5, Sodium 2,3,3-trichloroprop-2-ene-1-sulfonate, 2-Propene-1-sulfonic acid, 2,3,3-trichloro-, sodium salt, sodium;2,3,3-trichloroprop-2-ene-1-sulfonate, and SODIUM 2,3,3-TRICHLORO-2-PROPENSULFONATE.
What is the IUPAC name of Sodium 2,3,3-Trichloroprop-2-Ene-1-Sulfonate?
The IUPAC name is sodium;2,3,3-trichloroprop-2-ene-1-sulfonate.
What is the InChI of Sodium 2,3,3-Trichloroprop-2-Ene-1-Sulfonate?
The InChI is InChI=1S/C3H3Cl3O3S.Na/c4-2(3(5)6)1-10(7,8)9;/h1H2,(H,7,8,9);/q;+1/p-1.
What is the Canonical SMILES of Sodium 2,3,3-Trichloroprop-2-Ene-1-Sulfonate?
The Canonical SMILES is C(C(=C(Cl)Cl)Cl)S(=O)(=O)[O-].[Na+].
What is the CAS number of Sodium 2,3,3-Trichloroprop-2-Ene-1-Sulfonate?
The CAS number is 65600-61-5.
What is the molecular weight of Sodium?
The molecular weight of Sodium is not provided in the reference.
How many hydrogen bond acceptor counts are there in Sodium 2,3,3-Trichloroprop-2-Ene-1-Sulfonate?
There are 3 hydrogen bond acceptor counts.
Is Sodium 2,3,3-Trichloroprop-2-Ene-1-Sulfonate a covalently-bonded unit?
Yes, Sodium 2,3,3-Trichloroprop-2-Ene-1-Sulfonate is a covalently-bonded unit.
※ Please kindly note that our products are for research use only.