What is the molecular formula of 2-Propylnonanoic acid?
The molecular formula of 2-Propylnonanoic acid is C12H24O2.
What is the molecular weight of 2-Propylnonanoic acid?
The molecular weight of 2-Propylnonanoic acid is 200.32 g/mol.
What are the synonyms of 2-Propylnonanoic acid?
The synonyms of 2-Propylnonanoic acid include 65185-82-2, SCHEMBL218828, DTXSID00339024, and APKRDOMMNFBDSG-UHFFFAOYSA-N.
What is the IUPAC name of 2-Propylnonanoic acid?
The IUPAC name of 2-Propylnonanoic acid is 2-propylnonanoic acid.
What is the InChI of 2-Propylnonanoic acid?
The InChI of 2-Propylnonanoic acid is InChI=1S/C12H24O2/c1-3-5-6-7-8-10-11(9-4-2)12(13)14/h11H,3-10H2,1-2H3,(H,13,14).
What is the InChIKey of 2-Propylnonanoic acid?
The InChIKey of 2-Propylnonanoic acid is APKRDOMMNFBDSG-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Propylnonanoic acid?
The canonical SMILES of 2-Propylnonanoic acid is CCCCCCCC(CCC)C(=O)O.
What is the CAS number of 2-Propylnonanoic acid?
The CAS number of 2-Propylnonanoic acid is 65185-82-2.
What is the XLogP3 value of 2-Propylnonanoic acid?
The XLogP3 value of 2-Propylnonanoic acid is 4.3.
What is the hydrogen bond donor count of 2-Propylnonanoic acid?
The hydrogen bond donor count of 2-Propylnonanoic acid is 1.