What is the PubChem CID for 2-Bromo phenethylamin?
The PubChem CID for 2-Bromo phenethylamin is 2734091.
What is the molecular formula of 2-Bromo phenethylamin?
The molecular formula of 2-Bromo phenethylamin is C8H10BrN.
What is the molecular weight of 2-Bromo phenethylamin?
The molecular weight of 2-Bromo phenethylamin is 200.08 g/mol.
What is the IUPAC name of 2-Bromo phenethylamin?
The IUPAC name of 2-Bromo phenethylamin is 2-(2-bromophenyl)ethanamine.
What is the InChI code of 2-Bromo phenethylamin?
The InChI code of 2-Bromo phenethylamin is InChI=1S/C8H10BrN/c9-8-4-2-1-3-7(8)5-6-10/h1-4H,5-6,10H2.
What is the InChIKey of 2-Bromo phenethylamin?
The InChIKey of 2-Bromo phenethylamin is ITRNQMJXZUWZQL-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo phenethylamin?
The canonical SMILES of 2-Bromo phenethylamin is C1=CC=C(C(=C1)CCN)Br.
What is the CAS number of 2-Bromo phenethylamin?
The CAS number of 2-Bromo phenethylamin is 65185-58-2.
What is the XLogP3-AA value of 2-Bromo phenethylamin?
The XLogP3-AA value of 2-Bromo phenethylamin is 1.9.
Is 2-Bromo phenethylamin compound canonicalized?
Yes, 2-Bromo phenethylamin is canonicalized according to PubChem.