What is the molecular formula of 6-Bromoquinolin-4-amine?
The molecular formula is C9H7BrN2.
What is the molecular weight of 6-Bromoquinolin-4-amine?
The molecular weight is 223.07 g/mol.
What is the IUPAC name of 6-Bromoquinolin-4-amine?
The IUPAC name is 6-bromoquinolin-4-amine.
What is the InChI of 6-Bromoquinolin-4-amine?
The InChI is InChI=1S/C9H7BrN2/c10-6-1-2-9-7(5-6)8(11)3-4-12-9/h1-5H,(H2,11,12).
What is the InChIKey of 6-Bromoquinolin-4-amine?
The InChIKey is FNXZGQRYAJYZLP-UHFFFAOYSA-N.
What is the canonical SMILES of 6-Bromoquinolin-4-amine?
The canonical SMILES is C1=CC2=NC=CC(=C2C=C1Br)N.
What is the CAS number of 6-Bromoquinolin-4-amine?
The CAS number is 65340-73-0.
How many hydrogen bond donor counts does 6-Bromoquinolin-4-amine have?
It has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 6-Bromoquinolin-4-amine have?
It has 2 hydrogen bond acceptor counts.