What is the PubChem CID for Disperse Red 74?
PubChem CID 91895252
What is the molecular formula of Disperse Red 74?
The molecular formula is C22H25N5O7.
What are the synonyms for Disperse Red 74?
The synonyms are Disperse Red 74, 61703-11-5, C.I. Disperse Red 74, and MFCD23379954.
What is the molecular weight of Disperse Red 74?
The molecular weight is 471.5 g/mol.
When was Disperse Red 74 created?
It was created on October 5, 2015.
What is the IUPAC name of Disperse Red 74?
The IUPAC name is 2-[4-[(3-acetamido-4-nitrophenyl)diazenyl]-N-(2-acetyloxyethyl)anilino]ethyl acetate.
What is the InChI of Disperse Red 74?
The InChI is InChI=1S/C22H25N5O7/c1-15(28)23-21-14-19(6-9-22(21)27(31)32)25-24-18-4-7-20(8-5-18)26(10-12-33-16(2)29)11-13-34-17(3)30/h4-9,14H,10-13H2,1-3H3,(H,23,28).
What is the InChIKey of Disperse Red 74?
The InChIKey is AQMBXXOAUHJZIT-UHFFFAOYSA-N.
What is the CAS number of Disperse Red 74?
The CAS number is 61703-11-5.
Is Disperse Red 74 a canonicalized compound?
Yes, Disperse Red 74 is canonicalized according to PubChem.