What is the PubChem CID for Disperse Red 53?
PubChem CID 87343.
What is the molecular formula of Disperse Red 53?
The molecular formula is C19H19NO6.
What is the molecular weight of Disperse Red 53?
The molecular weight is 357.4 g/mol.
What is the IUPAC name of Disperse Red 53?
The IUPAC name is 1-amino-4-hydroxy-2-[2-(2-methoxyethoxy)ethoxy]anthracene-9,10-dione.
What is the InChI of Disperse Red 53?
The InChI is InChI=1S/C19H19NO6/c1-24-6-7-25-8-9-26-14-10-13(21)15-16(17(14)20)19(23)12-5-3-2-4-11(12)18(15)22/h2-5,10,21H,6-9,20H2,1H3.
What is the InChIKey of Disperse Red 53?
The InChIKey is CRMKCODPIHHCGA-UHFFFAOYSA-N.
What is the canonical SMILES of Disperse Red 53?
The canonical SMILES is COCCOCCOC1=C(C2=C(C(=C1)O)C(=O)C3=CC=CC=C3C2=O)N.
What is the CAS number of Disperse Red 53?
The CAS number is 59787-78-9.
How many hydrogen bond donor counts does Disperse Red 53 have?
Disperse Red 53 has 2 hydrogen bond donor counts.
What is the topological polar surface area of Disperse Red 53?
The topological polar surface area is 108 ?2.