What is the molecular formula of 4-Azidobutyric acid?
The molecular formula of 4-Azidobutyric acid is C4H7N3O2.
What are the synonyms for 4-Azidobutyric acid?
The synonyms for 4-Azidobutyric acid are 4-azidobutanoic acid and Butanoic acid, 4-azido-.
What is the molecular weight of 4-Azidobutyric acid?
The molecular weight of 4-Azidobutyric acid is 129.12 g/mol.
When was 4-Azidobutyric acid created?
4-Azidobutyric acid was created on October 27, 2006.
What is the IUPAC name of 4-Azidobutyric acid?
The IUPAC name of 4-Azidobutyric acid is 4-azidobutanoic acid.
What is the InChI of 4-Azidobutyric acid?
The InChI of 4-Azidobutyric acid is InChI=1S/C4H7N3O2/c5-7-6-3-1-2-4(8)9/h1-3H2,(H,8,9).
What is the InChIKey of 4-Azidobutyric acid?
The InChIKey of 4-Azidobutyric acid is WAGMYTXJRVPMGW-UHFFFAOYSA-N.
What is the canonical SMILES representation of 4-Azidobutyric acid?
The canonical SMILES representation of 4-Azidobutyric acid is C(CC(=O)O)CN=[N+]=[N-].
What is the CAS number for 4-Azidobutyric acid?
The CAS number for 4-Azidobutyric acid is 54447-68-6.
What is the XLogP3-AA value of 4-Azidobutyric acid?
The XLogP3-AA value of 4-Azidobutyric acid is 1.