What is the molecular formula of Pyrrolo[2,1-f][1,2,4]triazine-2,4(1H,3H)-dione?
The molecular formula is C6H5N3O2.
What are the synonyms for Pyrrolo[2,1-f][1,2,4]triazine-2,4(1H,3H)-dione?
The synonyms are 918538-04-2, Pyrrolo[2,1-f][1,2,4]triazine-2,4-dione, 1H,2H,3H,4H-PYRROLO[2,1-F][1,2,4]TRIAZINE-2,4-DIONE, 1H-pyrrolo[2,1-f][1,2,4]triazine-2,4-dione.
What is the molecular weight of Pyrrolo[2,1-f][1,2,4]triazine-2,4(1H,3H)-dione?
The molecular weight is 151.12 g/mol.
When was Pyrrolo[2,1-f][1,2,4]triazine-2,4(1H,3H)-dione created and modified?
It was created on February 12, 2007, and last modified on October 21, 2023.
What is the IUPAC name of Pyrrolo[2,1-f][1,2,4]triazine-2,4-dione?
The IUPAC name is 1H-pyrrolo[2,1-f][1,2,4]triazine-2,4-dione.
What is the InChI of Pyrrolo[2,1-f][1,2,4]triazine-2,4-dione?
The InChI is InChI=1S/C6H5N3O2/c10-5-4-2-1-3-9(4)8-6(11)7-5/h1-3H,(H2,7,8,10,11)
What is the InChIKey of Pyrrolo[2,1-f][1,2,4]triazine-2,4-dione?
The InChIKey is AQTRWCPNROUMPO-UHFFFAOYSA-N.
What is the Canonical SMILES of Pyrrolo[2,1-f][1,2,4]triazine-2,4-dione?
The Canonical SMILES is C1=CN2C(=C1)C(=O)NC(=O)N2.
What is the CAS number of Pyrrolo[2,1-f][1,2,4]triazine-2,4-dione?
The CAS number is 918538-04-2.
What is the formal charge and complexity of Pyrrolo[2,1-f][1,2,4]triazine-2,4-dione?
The formal charge is 0, and the complexity is 216.
※ Please kindly note that our products are for research use only.