What is the molecular formula of 2-Methyloctane?
The molecular formula of 2-Methyloctane is C9H20.
What is the molecular weight of 2-Methyloctane?
The molecular weight of 2-Methyloctane is 128.25 g/mol.
What is the IUPAC name of 2-Methyloctane?
The IUPAC name of 2-Methyloctane is 2-methyloctane.
What is the InChI of 2-Methyloctane?
The InChI of 2-Methyloctane is InChI=1S/C9H20/c1-4-5-6-7-8-9(2)3/h9H,4-8H2,1-3H3.
What is the InChIKey of 2-Methyloctane?
The InChIKey of 2-Methyloctane is ZUBZATZOEPUUQF-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Methyloctane?
The canonical SMILES of 2-Methyloctane is CCCCCCC(C)C.
What is the CAS number of 2-Methyloctane?
The CAS number of 2-Methyloctane is 3221-61-2.
What is the UNII of 2-Methyloctane?
The UNII of 2-Methyloctane is AV5KXW7I9L.
What is the XLogP3-AA value of 2-Methyloctane?
The XLogP3-AA value of 2-Methyloctane is 4.8.
What is the rotatable bond count of 2-Methyloctane?
The rotatable bond count of 2-Methyloctane is 5.