What is the PubChem CID for cis-Decahydronaphthalene?
The PubChem CID for cis-Decahydronaphthalene is 7044.
What is the molecular formula of cis-Decahydronaphthalene?
The molecular formula of cis-Decahydronaphthalene is C10H18.
What is the molecular weight of cis-Decahydronaphthalene?
The molecular weight of cis-Decahydronaphthalene is 138.25 g/mol.
What is the IUPAC name of cis-Decahydronaphthalene?
The IUPAC name of cis-Decahydronaphthalene is 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
What is the InChI of cis-Decahydronaphthalene?
The InChI of cis-Decahydronaphthalene is InChI=1S/C10H18/c1-2-6-10-8-4-3-7-9(10)5-1/h9-10H,1-8H2.
What is the InChIKey of cis-Decahydronaphthalene?
The InChIKey of cis-Decahydronaphthalene is NNBZCPXTIHJBJL-UHFFFAOYSA-N.
What is the canonical SMILES of cis-Decahydronaphthalene?
The canonical SMILES of cis-Decahydronaphthalene is C1CCC2CCCCC2C1.
What are the synonyms of cis-Decahydronaphthalene?
The synonyms of cis-Decahydronaphthalene include Decalin, trans-Decahydronaphthalene, and 91-17-8.
Is cis-Decahydronaphthalene soluble in water?
No, cis-Decahydronaphthalene is insoluble in water.
What are the other identifiers of cis-Decahydronaphthalene?
The other identifiers of cis-Decahydronaphthalene include CAS number 91-17-8, UNII 88451Q4XYF, and ChEMBL ID CHEMBL1491920.