What is the molecular formula of DL-Thyroxine?
The molecular formula of DL-Thyroxine is C15H11I4NO4.
What are the synonyms for DL-Thyroxine?
The synonyms for DL-Thyroxine are:
Thyroxine, dl-
2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoic acid
What is the molecular weight of DL-Thyroxine?
The molecular weight of DL-Thyroxine is 776.87 g/mol.
What is the role of DL-Thyroxine?
DL-Thyroxine has a role as a mitogen.
What type of compound is DL-Thyroxine?
DL-Thyroxine is an iodothyronine compound.
What are the computed descriptors for DL-Thyroxine?
The computed descriptors for DL-Thyroxine are:
IUPAC Name: 2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoic acid
InChI: InChI=1S/C15H11I4NO4/c16-8-4-7(5-9(17)13(8)21)24-14-10(18)1-6(2-11(14)19)3-12(20)15(22)23/h1-2,4-5,12,21H,3,20H2,(H,22,23)
InChIKey: XUIIKFGFIJCVMT-UHFFFAOYSA-N
Canonical SMILES: C1=C(C=C(C(=C1I)OC2=CC(=C(C(=C2)I)O)I)I)CC(C(=O)O)N
What is the CAS number of DL-Thyroxine?
The CAS number of DL-Thyroxine is 300-30-1.
What is the European Community (EC) number of DL-Thyroxine?
The European Community (EC) number of DL-Thyroxine is 206-088-9.
What is the DSSTox Substance ID of DL-Thyroxine?
The DSSTox Substance ID of DL-Thyroxine is DTXSID0023662.
What is the ChEMBL ID of DL-Thyroxine?
The ChEMBL ID of DL-Thyroxine is CHEMBL42115.