What is the molecular formula of 8-[Fluo]-cAMP?
The molecular formula of 8-[Fluo]-cAMP is C33H27N7O11PS2-.
What is the molecular weight of 8-[Fluo]-cAMP?
The molecular weight of 8-[Fluo]-cAMP is 792.7 g/mol.
What is the parent compound of 8-[Fluo]-cAMP?
The parent compound of 8-[Fluo]-cAMP is not mentioned in the reference.
When was 8-[Fluo]-cAMP created?
8-[Fluo]-cAMP was created on March 25, 2017.
When was 8-[Fluo]-cAMP last modified?
8-[Fluo]-cAMP was last modified on October 21, 2023.
What is the IUPAC name of 8-[Fluo]-cAMP?
The IUPAC name of 8-[Fluo]-cAMP is 5-[2-[6-amino-9-(7-hydroxy-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl)purin-8-yl]sulfanylethylcarbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
What is the InChI of 8-[Fluo]-cAMP?
The InChI of 8-[Fluo]-cAMP is InChI=1S/C33H28N7O11PS2/c34-28-25-29(37-13-36-28)40(30-26(43)27-23(50-30)12-48-52(46,47)51-27)33(39-25)54-8-7-35-32(53)38-14-1-4-17(20(9-14)31(44)45)24-18-5-2-15(41)10-21(18)49-22-11-16(42)3-6-19(22)24/h1-6,9-11,13,23,26-27,30,41,43H,7-8,12H2,(H,44,45)(H,46,47)(H2,34,36,37)(H2,35,38,53)/p-1.
What is the InChIKey of 8-[Fluo]-cAMP?
The InChIKey of 8-[Fluo]-cAMP is CQCCASCBDPGSNI-UHFFFAOYSA-M.
What is the canonical SMILES of 8-[Fluo]-cAMP?
The canonical SMILES of 8-[Fluo]-cAMP is C1C2C(C(C(O2)N3C4=NC=NC(=C4N=C3SCCNC(=S)NC5=CC(=C(C=C5)C6=C7C=CC(=O)C=C7OC8=C6C=CC(=C8)O)C(=O)O)N)O)OP(=O)(O1)[O-].
How many hydrogen bond donor count does 8-[Fluo]-cAMP have?
8-[Fluo]-cAMP has 6 hydrogen bond donor counts.