What is the molecular formula of cholesteryl 9-anthracenecarboxylate?
The molecular formula is C42H54O2.
What is the synonym for cholesteryl 9-anthracenecarboxylate?
The synonym is 9-Anthracenecarboxylic acid cholesteryl ester.
What is the PubChem CID for cholesteryl 9-anthracenecarboxylate?
The PubChem CID is 10289946.
When was cholesteryl 9-anthracenecarboxylate created in PubChem?
It was created on October 25, 2006.
What is the molecular weight of cholesteryl 9-anthracenecarboxylate?
The molecular weight is 590.9 g/mol.
What is the IUPAC name of cholesteryl 9-anthracenecarboxylate?
The IUPAC name is [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] anthracene-9-carboxylate.
What is the InChIKey of cholesteryl 9-anthracenecarboxylate?
The InChIKey is FMGWOPYZVAWWNP-SKWQCYOWSA-N.
What is the canonical SMILES of cholesteryl 9-anthracenecarboxylate?
The canonical SMILES is CC(C)CCCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)OC(=O)C5=C6C=CC=CC6=CC7=CC=CC=C75)C)C.
What is the CAS number for cholesteryl 9-anthracenecarboxylate?
The CAS number is 2641-40-9.
What is the XLogP3-AA value of cholesteryl 9-anthracenecarboxylate?
The XLogP3-AA value is 13.3.
※ Please kindly note that our products are for research use only.