What is the molecular formula of 2-chloro-4-methylpentane?
The molecular formula of 2-chloro-4-methylpentane is C6H13Cl.
What are some synonyms for 2-chloro-4-methylpentane?
Some synonyms for 2-chloro-4-methylpentane are:
Pentane, 2-chloro-4-methyl-
2-chloro-4-methyl-pentane
What is the molecular weight of 2-chloro-4-methylpentane?
The molecular weight of 2-chloro-4-methylpentane is 120.62 g/mol.
What is the IUPAC name of 2-chloro-4-methylpentane?
The IUPAC name of 2-chloro-4-methylpentane is 2-chloro-4-methylpentane.
What is the InChI of 2-chloro-4-methylpentane?
The InChI of 2-chloro-4-methylpentane is InChI=1S/C6H13Cl/c1-5(2)4-6(3)7/h5-6H,4H2,1-3H3.
What is the InChIKey of 2-chloro-4-methylpentane?
The InChIKey of 2-chloro-4-methylpentane is WIMBRKMSNRCNMP-UHFFFAOYSA-N.
What is the canonical SMILES of 2-chloro-4-methylpentane?
The canonical SMILES of 2-chloro-4-methylpentane is CC(C)CC(C)Cl.
What is the CAS number of 2-chloro-4-methylpentane?
The CAS number of 2-chloro-4-methylpentane is 25346-32-1.
How many rotatable bonds does 2-chloro-4-methylpentane have?
2-chloro-4-methylpentane has 2 rotatable bonds.
Is 2-chloro-4-methylpentane a canonicalized compound?
Yes, 2-chloro-4-methylpentane is a canonicalized compound.
Download
![N-[2-[(2-bromo-6-cyano-4-nitrophenyl)azo]-5-(diethylamino)phenyl]acetamide](https://resource.alfa-chemistry.com/structure/2537-62-4.gif)
