What is the molecular formula of isodecylphosphite?
The molecular formula of isodecylphosphite is C30H63O3P.
What are the synonyms of isodecylphosphite?
The synonyms of isodecylphosphite are triisodecyl phosphite, Phosphorous Acid Triisodecyl Ester, and tris(8-methylnonyl) phosphite.
What is the molecular weight of isodecylphosphite?
The molecular weight of isodecylphosphite is 502.8 g/mol.
When was isodecylphosphite created and modified?
Isodecylphosphite was created on August 8, 2005, and it was last modified on October 21, 2023.
What is the IUPAC name of isodecylphosphite?
The IUPAC name of isodecylphosphite is tris(8-methylnonyl) phosphite.
What is the InChI of isodecylphosphite?
The InChI of isodecylphosphite is InChI=1S/C30H63O3P/c1-28(2)22-16-10-7-13-19-25-31-34(32-26-20-14-8-11-17-23-29(3)4)33-27-21-15-9-12-18-24-30(5)6/h28-30H,7-27H2,1-6H3.
What is the InChIKey of isodecylphosphite?
The InChIKey of isodecylphosphite is QEDNBHNWMHJNAB-UHFFFAOYSA-N.
What is the canonical SMILES of isodecylphosphite?
The canonical SMILES of isodecylphosphite is CC(C)CCCCCCCOP(OCCCCCCCC(C)C)OCCCCCCCC(C)C.
What is the CAS number of isodecylphosphite?
The CAS number of isodecylphosphite is 25448-25-3.
What is the physical description of isodecylphosphite?
Isodecylphosphite is described as a dry powder or liquid.