What is the molecular formula of 1h,1h-Perfluoro-3,6,9-trioxadecan-1-ol?
The molecular formula is CF3O(CF2CF2O)2CF2CH2OHC7H3F13O4.
What are the synonyms for 1h,1h-Perfluoro-3,6,9-trioxadecan-1-ol?
The synonyms are 147492-57-7, Fluorinated triethylene glycol monomethyl ether, and 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]ethanol.
What is the molecular weight of 1h,1h-Perfluoro-3,6,9-trioxadecan-1-ol?
The molecular weight is 398.07 g/mol.
What is the IUPAC name of 1h,1h-Perfluoro-3,6,9-trioxadecan-1-ol?
The IUPAC name is 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]ethanol.
What is the InChI of 1h,1h-Perfluoro-3,6,9-trioxadecan-1-ol?
The InChI is InChI=1S/C7H3F13O4/c8-2(9,1-21)22-3(10,11)4(12,13)23-5(14,15)6(16,17)24-7(18,19)20/h21H,1H2.
What is the InChIKey of 1h,1h-Perfluoro-3,6,9-trioxadecan-1-ol?
The InChIKey is PGUFRYZQAPBGDW-UHFFFAOYSA-N.
What is the canonical SMILES of 1h,1h-Perfluoro-3,6,9-trioxadecan-1-ol?
The canonical SMILES is C(C(OC(C(OC(C(OC(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O.
What is the CAS number of 1h,1h-Perfluoro-3,6,9-trioxadecan-1-ol?
The CAS number is 147492-57-7.
What is the European Community (EC) number of 1h,1h-Perfluoro-3,6,9-trioxadecan-1-ol?
The European Community (EC) number is 671-184-3.
What is the molecular weight, XLogP3-AA, hydrogen bond donor count, hydrogen bond acceptor count, rotatable bond count, and topological polar surface area of 1h,1h-Perfluoro-3,6,9-trioxadecan-1-ol?
The molecular weight is 398.07 g/mol. The XLogP3-AA is 4.2. The hydrogen bond donor count is 1. The hydrogen bond acceptor count is 17. The rotatable bond count is 8. The topological polar surface area is 47.9Ų.
※ Please kindly note that our products are for research use only.