What is the molecular formula of 5-amino-2,3-dihydro-1,3-benzoxazol-2-one?
The molecular formula is C7H6N2O2.
What is the molecular weight of 5-amino-2,3-dihydro-1,3-benzoxazol-2-one?
The molecular weight is 150.13 g/mol.
What are the synonyms of 5-amino-2,3-dihydro-1,3-benzoxazol-2-one?
The synonyms include 14733-77-8, 5-Aminobenzo[d]oxazol-2(3H)-one, 2(3H)-Benzoxazolone, 5-amino-, 5-amino-1,3-benzoxazol-2(3H)-one, and 5-amino-3H-1,3-benzoxazol-2-one.
What is the IUPAC name of 5-amino-2,3-dihydro-1,3-benzoxazol-2-one?
The IUPAC name is 5-amino-3H-1,3-benzoxazol-2-one.
What is the InChI of 5-amino-2,3-dihydro-1,3-benzoxazol-2-one?
The InChI is InChI=1S/C7H6N2O2/c8-4-1-2-6-5(3-4)9-7(10)11-6/h1-3H,8H2,(H,9,10).
What is the InChIKey of 5-amino-2,3-dihydro-1,3-benzoxazol-2-one?
The InChIKey is GJXXUHGUCBUXSL-UHFFFAOYSA-N.
What is the canonical SMILES of 5-amino-2,3-dihydro-1,3-benzoxazol-2-one?
The canonical SMILES is C1=CC2=C(C=C1N)NC(=O)O2.
What is the CAS number of 5-amino-2,3-dihydro-1,3-benzoxazol-2-one?
The CAS number is 14733-77-8.
What is the XLogP3 value of 5-amino-2,3-dihydro-1,3-benzoxazol-2-one?
The XLogP3 value is 0.5.
How many hydrogen bond acceptors does 5-amino-2,3-dihydro-1,3-benzoxazol-2-one have?
It has 3 hydrogen bond acceptors.
※ Please kindly note that our products are for research use only.