What is the molecular formula of 2,6-Dibromonaphthalene?
The molecular formula of 2,6-Dibromonaphthalene is C10H6Br2.
What is the molecular weight of 2,6-Dibromonaphthalene?
The molecular weight of 2,6-Dibromonaphthalene is 285.96 g/mol.
What is the IUPAC name of 2,6-Dibromonaphthalene?
The IUPAC name of 2,6-Dibromonaphthalene is 2,6-dibromonaphthalene.
What is the InChI of 2,6-Dibromonaphthalene?
The InChI of 2,6-Dibromonaphthalene is InChI=1S/C10H6Br2/c11-9-3-1-7-5-10(12)4-2-8(7)6-9/h1-6H.
What is the InChIKey of 2,6-Dibromonaphthalene?
The InChIKey of 2,6-Dibromonaphthalene is PJZDEYKZSZWFPX-UHFFFAOYSA-N.
What is the canonical SMILES of 2,6-Dibromonaphthalene?
The canonical SMILES of 2,6-Dibromonaphthalene is C1=CC2=C(C=CC(=C2)Br)C=C1Br.
What is the CAS number of 2,6-Dibromonaphthalene?
The CAS number of 2,6-Dibromonaphthalene is 13720-06-4.
What is the EC number of 2,6-Dibromonaphthalene?
The EC number of 2,6-Dibo"romonaphthalene is 803-009-5.
Is 2,6-Dibromonaphthalene a covalently-bonded unit?
Yes, 2,6-Dibromonaphthalene is a covalently-bonded unit.