What is the PubChem CID for 2-Aminobenzhydrol?
PubChem CID 270810.
What is the molecular formula of 2-Aminobenzhydrol?
The molecular formula is C13H13NO.
What is the molecular weight of 2-Aminobenzhydrol?
The molecular weight is 199.25 g/mol.
What is the IUPAC name of 2-Aminobenzhydrol?
The IUPAC name is (2-aminophenyl)-phenylmethanol.
What is the InChI of 2-Aminobenzhydrol?
The InChI is InChI=1S/C13H13NO/c14-12-9-5-4-8-11(12)13(15)10-6-2-1-3-7-10/h1-9,13,15H,14H2.
What is the InChIKey of 2-Aminobenzhydrol?
The InChIKey is NAWYZLGDGZTAPN-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Aminobenzhydrol?
The canonical SMILES is C1=CC=C(C=C1)C(C2=CC=CC=C2N)O.
What is the CAS number of 2-Aminobenzhydrol?
The CAS number is 13209-38-6.
What is the EC number of 2-Aminobenzhydrol?
The EC number is 639-294-6.
Is 2-Aminobenzhydrol a canonicalized compound?
Yes, 2-Aminobenzhydrol is a canonicalized compound according to PubChem.