What is the molecular formula of glutaric anhydride?
The molecular formula of glutaric anhydride is C5H6O3.
What is the molecular weight of glutaric anhydride?
The molecular weight of glutaric anhydride is 114.10 g/mol.
What are some synonyms of glutaric anhydride?
Some synonyms of glutaric anhydride include dihydro-2H-pyran-2,6(3H)-dione, oxane-2,6-dione, and glutaric acid anhydride.
What is the IUPAC name of glutaric anhydride?
The IUPAC name of glutaric anhydride is oxane-2,6-dione.
What is the InChI of glutaric anhydride?
The InChI of glutaric anhydride is InChI=1S/C5H6O3/c6-4-2-1-3-5(7)8-4/h1-3H2.
What is the InChIKey of glutaric anhydride?
The InChIKey of glutaric anhydride is VANNPISTIUFMLH-UHFFFAOYSA-N.
What is the canonical SMILES of glutaric anhydride?
The canonical SMILES of glutaric anhydride is C1CC(=O)OC(=O)C1.
What is the CAS number of glutaric anhydride?
The CAS number of glutaric anhydride is 108-55-4.
What is the EC number of glutaric anhydride?
The EC number of glutaric anhydride is 203-593-6.