What is the molecular formula of Calystegine B3?
The molecular formula of Calystegine B3 is C7H13NO4.
What are the synonyms for Calystegine B3?
The synonyms for Calystegine B3 are 178231-95-3 and (+)-Calystegine B3.
What is the molecular weight of Calystegine B3?
The molecular weight of Calystegine B3 is 175.18 g/mol.
When was Calystegine B3 created?
Calystegine B3 was created on December 10, 2015.
What is the IUPAC name of Calystegine B3?
The IUPAC name of Calystegine B3 is (1S,2R,3R,4S,5S)-8-azabicyclo[3.2.1]octane-1,2,3,4-tetrol.
What is the InChI of Calystegine B3?
The InChI of Calystegine B3 is InChI=1S/C7H13NO4/c9-4-3-1-2-7(12,8-3)6(11)5(4)10/h3-6,8-12H,1-2H2/t3-,4-,5+,6+,7-/m0/s1.
What is the InChIKey of Calystegine B3?
The InChIKey of Calystegine B3 is FXFBVZOJVHCEDO-TYDWOXHJSA-N.
What is the Canonical SMILES of Calystegine B3?
The Canonical SMILES of Calystegine B3 is C1CC2(C(C(C(C1N2)O)O)O)O.
What is the CAS number of Calystegine B3?
The CAS number of Calystegine B3 is 178231-95-3.
What is the hydrogen bond donor count of Calystegine B3?
The hydrogen bond donor count of Calystegine B3 is 5.