What is the molecular formula of flucarbazone sodium?
The molecular formula of flucarbazone sodium is C12H10F3N4NaO6S.
What is another name for flucarbazone sodium?
Another name for flucarbazone sodium is Flucarbazone-sodium.
What is the molecular weight of flucarbazone sodium?
The molecular weight of flucarbazone sodium is 418.28 g/mol.
What is the role of flucarbazone-sodium?
Flucarbazone-sodium is an EC 2.2.1.6 (acetolactate synthase) inhibitor, a herbicide, and an agrochemical.
How is flucarbazone-sodium used?
Flucarbazone-sodium is used as a herbicide to control grass weeds in cereal crops.
Is flucarbazone sodium approved for use within the European Union?
No, flucarbazone sodium is not approved for use within the European Union.
What is the IUPAC name of flucarbazone sodium?
The IUPAC name of flucarbazone sodium is sodium;(3-methoxy-4-methyl-5-oxo-1,2,4-triazole-1-carbonyl)-[2-(trifluoromethoxy)phenyl]sulfonylazanide.
What is the InChIKey of flucarbazone sodium?
The InChIKey of flucarbazone sodium is UOUXAYAIONPXDH-UHFFFAOYSA-M.
What is the canonical SMILES of flucarbazone sodium?
The canonical SMILES of flucarbazone sodium is CN1C(=NN(C1=O)C(=O)[N-]S(=O)(=O)C2=CC=CC=C2OC(F)(F)F)OC.[Na+].
What is the CAS number of flucarbazone sodium?
The CAS number of flucarbazone sodium is 181274-17-9.