What is the PubChem CID for Biopol?
The PubChem CID for Biopol is 107801.
What is the molecular formula of Biopol?
The molecular formula of Biopol is C9H18O6.
What are the synonyms for Biopol?
The synonyms for Biopol are 3-hydroxybutanoic acid and 3-hydroxypentanoic acid.
What is the molecular weight of Biopol?
The molecular weight of Biopol is 222.24 g/mol.
What is the IUPAC name of Biopol?
The IUPAC name of Biopol is 3-hydroxybutanoic acid;3-hydroxypentanoic acid.
What is the InChI of Biopol?
The InChI of Biopol is InChI=1S/C5H10O3.C4H8O3/c1-2-4(6)3-5(7)8;1-3(5)2-4(6)7/h4,6H,2-3H2,1H3,(H,7,8);3,5H,2H2,1H3,(H,6,7).
What is the InChIKey of Biopol?
The InChIKey of Biopol is IUPHTVOTTBREAV-UHFFFAOYSA-N.
What is the canonical SMILES of Biopol?
The canonical SMILES of Biopol is CCC(CC(=O)O)O.CC(CC(=O)O)O.
What is the CAS number of Biopol?
The CAS number of Biopol is 80181-31-3.
What is the European Community (EC) number of Biopol?
The European Community (EC) number of Biopol is 616-996-0.