Adogen 464

• Catalog Number: ACM72749598
• Product Name: Adogen 464
• CAS: 72749-59-8
• Category: Polymer/Macromolecule
• Synonyms: Quaternaryammoniumcompounds,tri-C6-12-alkylmethyl,chlorides;464;Adogen¨(C6-C12)Trialkylmethylammonium chloride;Einecs 276-811-0;Tri-C6-12-alkyl methyl ammonium chloride;Tri-C6-12-alkylmethyl ammonium chlorides;Adogen 464,Methyltrialkyl(C8-C10)ammonium

Custom Q&A

What is the molecular formula of Adogen 464?

The molecular formula of Adogen 464 is C25H54ClN.

What is the molecular weight of Adogen 464?

The molecular weight of Adogen 464 is 404.2 g/mol.

What is the IUPAC name of Adogen 464?

The IUPAC name of Adogen 464 is methyl(trioctyl)azanium;chloride.

What is the InChIKey of Adogen 464?

The InChIKey of Adogen 464 is XKBGEWXEAPTVCK-UHFFFAOYSA-M.

What is the canonical SMILES of Adogen 464?

The canonical SMILES of Adogen 464 is CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC.[Cl-].

What is the CAS number of Adogen 464?

The CAS number of Adogen 464 is 5137-55-3.

What is the UNII of Adogen 464?

The UNII of Adogen 464 is 07Q8S2MJ6A.

How many hydrogen bond donor counts does Adogen 464 have?

Adogen 464 has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does Adogen 464 have?

Adogen 464 has 1 hydrogen bond acceptor count.

How many rotatable bond counts does Adogen 464 have?

Adogen 464 has 21 rotatable bond counts.