What is the molecular formula of 7-Octenoic acid?
The molecular formula of 7-Octenoic acid is C8H14O2.
What is the molecular weight of 7-Octenoic acid?
The molecular weight of 7-Octenoic acid is 142.20 g/mol.
What is the IUPAC name of 7-Octenoic acid?
The IUPAC name of 7-Octenoic acid is oct-7-enoic acid.
What is the InChI of 7-Octenoic acid?
The InChI of 7-Octenoic acid is InChI=1S/C8H14O2/c1-2-3-4-5-6-7-8(9)10/h2H,1,3-7H2,(H,9,10).
What is the InChIKey of 7-Octenoic acid?
The InChIKey of 7-Octenoic acid is OZYYQTRHHXLTKX-UHFFFAOYSA-N.
What is the canonical SMILES of 7-Octenoic acid?
The canonical SMILES of 7-Octenoic acid is C=CCCCCCC(=O)O.
What is the CAS number of 7-Octenoic acid?
The CAS number of 7-Octenoic acid is 18719-24-9.
What is the European Community (EC) number of 7-Octenoic acid?
The European Community (EC) number of 7-Octenoic acid is 686-909-9.
What is the UNII of 7-Octenoic acid?
The UNII of 7-Octenoic acid is UMY8YV4JPR.
Is 7-Octenoic acid a canonicalized compound?
Yes, 7-Octenoic acid is a canonicalized compound.