What is the molecular formula of 1-Allyl-4-fluorobenzene?
The molecular formula of 1-Allyl-4-fluorobenzene is C9H9F.
What is the molecular weight of 1-Allyl-4-fluorobenzene?
The molecular weight of 1-Allyl-4-fluorobenzene is 136.17 g/mol.
What is the IUPAC Name of 1-Allyl-4-fluorobenzene?
The IUPAC Name of 1-Allyl-4-fluorobenzene is 1-fluoro-4-prop-2-enylbenzene.
What is the InChI of 1-Allyl-4-fluorobenzene?
The InChI of 1-Allyl-4-fluorobenzene is InChI=1S/C9H9F/c1-2-3-8-4-6-9(10)7-5-8/h2,4-7H,1,3H2.
What is the InChIKey of 1-Allyl-4-fluorobenzene?
The InChIKey of 1-Allyl-4-fluorobenzene is NYFIDHXRJSCAOZ-UHFFFAOYSA-N.
What is the Canonical SMILES of 1-Allyl-4-fluorobenzene?
The Canonical SMILES of 1-Allyl-4-fluorobenzene is C=CCC1=CC=C(C=C1)F.
What is the CAS number of 1-Allyl-4-fluorobenzene?
The CAS number of 1-Allyl-4-fluorobenzene is 1737-16-2.
What is the European Community (EC) Number of 1-Allyl-4-fluorobenzene?
The European Community (EC) Number of 1-Allyl-4-fluorobenzene is 624-269-4.
What is the XLogP3-AA value of 1-Allyl-4-fluorobenzene?
The XLogP3-AA value of 1-Allyl-4-fluorobenzene is 3.1.
Is 1-Allyl-4-fluorobenzene a Covalently-Bonded Unit?
Yes, 1-Allyl-4-fluorobenzene is a Covalently-Bonded Unit.