What is the molecular formula of 5-Nitro-2-furoic acid?
The molecular formula of 5-Nitro-2-furoic acid is C5H3NO5.
What are the synonyms of 5-Nitro-2-furoic acid?
The synonyms of 5-Nitro-2-furoic acid are 5-NITRO-2-FUROIC ACID, 645-12-5, 5-Nitrofuran-2-carboxylic acid, Nitrofurate, and 5-Nitrofuroic acid.
What is the molecular weight of 5-Nitro-2-furoic acid?
The molecular weight of 5-Nitro-2-furoic acid is 157.08 g/mol.
When was 5-Nitro-2-furoic acid created?
5-Nitro-2-furoic acid was created on March 26, 2005.
When was 5-Nitro-2-furoic acid last modified?
5-Nitro-2-furoic acid was last modified on October 21, 2023.
What is the IUPAC name of 5-Nitro-2-furoic acid?
The IUPAC name of 5-Nitro-2-furoic acid is 5-nitrofuran-2-carboxylic acid.
What is the InChI of 5-Nitro-2-furoic acid?
The InChI of 5-Nitro-2-furoic acid is InChI=1S/C5H3NO5/c7-5(8)3-1-2-4(11-3)6(9)10/h1-2H,(H,7,8)
What is the InChIKey of 5-Nitro-2-furoic acid?
The InChIKey of 5-Nitro-2-furoic acid is IODMEDPPCXSFLD-UHFFFAOYSA-N.
What is the CAS number of 5-Nitro-2-furoic acid?
The CAS number of 5-Nitro-2-furoic acid is 645-12-5.
What is the formal charge of 5-Nitro-2-furoic acid?
The formal charge of 5-Nitro-2-furoic acid is 0.