What is the molecular formula of 3-Methylnonadecane?
The molecular formula is C20H42.
What are some synonyms for 3-Methylnonadecane?
Some synonyms for 3-Methylnonadecane are Nonadecane, 3-methyl- and 3-me-thylnonadecane.
When was 3-Methylnonadecane created and modified?
3-Methylnonadecane was created on 2005-03-27 and last modified on 2023-10-21.
Where is 3-Methylnonadecane found naturally?
3-Methylnonadecane is found naturally in Vanilla planifolia and Vanilla madagascariensis.
What is the IUPAC name of 3-Methylnonadecane?
The IUPAC name of 3-Methylnonadecane is 3-methylnonadecane.
What is the InChI of 3-Methylnonadecane?
The InChI of 3-Methylnonadecane is InChI=1S/C20H42/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(3)5-2/h20H,4-19H2,1-3H3.
What is the InChIKey of 3-Methylnonadecane?
The InChIKey of 3-Methylnonadecane is NYRRMADCQLTNBX-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Methylnonadecane?
The canonical SMILES of 3-Methylnonadecane is CCCCCCCCCCCCCCCCC(C)CC.
What is the CAS number of 3-Methylnonadecane?
The CAS number of 3-Methylnonadecane is 6418-45-7.
What is the XLogP3-AA value of 3-Methylnonadecane?
The XLogP3-AA value of 3-Methylnonadecane is 10.8.